C20H18N2O4 — CID 134110448
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(3-methylphenyl)benzaldehyde (PubChem CID 134110448) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(3-methylphenyl)benzaldehyde.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(3-methylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 134110448 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(3-methylphenyl)benzaldehyde |
| SMILES | COc1cc(OC)nc(Oc2cccc(-c3cccc(C)c3)c2C=O)n1 |
| InChI | InChI=1S/C20H18N2O4/c1-13-6-4-7-14(10-13)15-8-5-9-17(16(15)12-23)26-20-21-18(24-2)11-19(22-20)25-3/h4-12H,1-3H3 |
| InChIKey | YJPFCOWTYUYOOH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|