C17H21N3O3 — CID 134111044
[(Z)-(2-morpholin-4-ylcyclohex-2-en-1-ylidene)amino] N-phenylcarbamate (PubChem CID 134111044) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(Z)-(2-morpholin-4-ylcyclohex-2-en-1-ylidene)amino] N-phenylcarbamate.
| Compound Name | [(Z)-(2-morpholin-4-ylcyclohex-2-en-1-ylidene)amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 134111044 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [(Z)-(2-morpholin-4-ylcyclohex-2-en-1-ylidene)amino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O/N=C1/CCCC=C1N1CCOCC1 |
| InChI | InChI=1S/C17H21N3O3/c21-17(18-14-6-2-1-3-7-14)23-19-15-8-4-5-9-16(15)20-10-12-22-13-11-20/h1-3,6-7,9H,4-5,8,10-13H2,(H,18,21)/b19-15- |
| InChIKey | RWPLNETUKFAWQL-CYVLTUHYSA-N |
| XLogP | 2.99 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|