N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride

C16H13ClN4O — CID 134111140

IUPACN,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride
SMILESO=C(Nc1ccncc1)c1ccc[n+](-c2ccncc2)c1.[Cl-]
InChIInChI=1S/C16H12N4O.ClH/c21-16(19-14-3-7-17-8-4-14)13-2-1-11-20(12-13)15-5-9-18-10-6-15;/h1-12H;1H
InChIKeyBKWHSQTXEJAQSV-UHFFFAOYSA-N
MW312.76 g/mol
LogP-0.99
Rot. Bonds3

About N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride

N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride (PubChem CID 134111140) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride.

Molecular Properties

Compound NameN,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride
PubChem CID134111140
Molecular FormulaC16H13ClN4O
Molecular Weight312.76 g/mol
Exact Mass312.08
IUPAC NameN,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride
SMILESO=C(Nc1ccncc1)c1ccc[n+](-c2ccncc2)c1.[Cl-]
InChIInChI=1S/C16H12N4O.ClH/c21-16(19-14-3-7-17-8-4-14)13-2-1-11-20(12-13)15-5-9-18-10-6-15;/h1-12H;1H
InChIKeyBKWHSQTXEJAQSV-UHFFFAOYSA-N
XLogP-0.99
TPSA58.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.76
LogP ≤ 5-0.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride?
The IUPAC name of N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride (CID 134111140) is N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride.
What is the SMILES notation for N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride?
The canonical SMILES for N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride is O=C(Nc1ccncc1)c1ccc[n+](-c2ccncc2)c1.[Cl-].
What is the InChIKey of N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride?
The InChIKey is BKWHSQTXEJAQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O.ClH/c21-16(19-14-3-7-17-8-4-14)13-2-1-11-20(12-13)15-5-9-18-10-6-15;/h1-12H;1H.
What are the key properties of N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride?
N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride has a molecular weight of 312.76 g/mol, XLogP of -0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dipyridin-4-ylpyridin-1-ium-3-carboxamide chloride is sourced from PubChem (CID 134111140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).