C12H11ClN2O2S — CID 134113920
N-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-1-carbothioamide (PubChem CID 134113920) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-1-carbothioamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134113920 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-1-carbothioamide |
| SMILES | Cc1cc(Cl)ccc1NC(=S)N1C(=O)CCC1=O |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7-6-8(13)2-3-9(7)14-12(18)15-10(16)4-5-11(15)17/h2-3,6H,4-5H2,1H3,(H,14,18) |
| InChIKey | SBVFMWFSHJWKCQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|