C14H15ClF3N3OS — CID 3282424
N-[1-[(4-chloro-2-methylphenyl)carbamothioyl]pyrrolidin-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 3282424) has the molecular formula C14H15ClF3N3OS and a molecular weight of 365.81 g/mol. Its IUPAC name is N-[1-[(4-chloro-2-methylphenyl)carbamothioyl]pyrrolidin-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[(4-chloro-2-methylphenyl)carbamothioyl]pyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 3282424 |
| Molecular Formula | C14H15ClF3N3OS |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[1-[(4-chloro-2-methylphenyl)carbamothioyl]pyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=S)N1CCC(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H15ClF3N3OS/c1-8-6-9(15)2-3-11(8)20-13(23)21-5-4-10(7-21)19-12(22)14(16,17)18/h2-3,6,10H,4-5,7H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | OMGJPIYIBLLJNH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|