C21H19N3O2 — CID 134115383
1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclopentane-1-carbonitrile (PubChem CID 134115383) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclopentane-1-carbonitrile.
| Compound Name | 1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 134115383 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclopentane-1-carbonitrile |
| SMILES | N#CC1(C2C(=O)N(c3ccccc3)N(c3ccccc3)C2=O)CCCC1 |
| InChI | InChI=1S/C21H19N3O2/c22-15-21(13-7-8-14-21)18-19(25)23(16-9-3-1-4-10-16)24(20(18)26)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-14H2 |
| InChIKey | JSKSRSUEVDODSW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|