C25H19F4N3O4 — CID 134115532
4-(1,3-benzodioxol-5-yl)-5-phenyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 134115532) has the molecular formula C25H19F4N3O4 and a molecular weight of 501.44 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-5-phenyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-5-phenyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 134115532 |
| Molecular Formula | C25H19F4N3O4 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-5-phenyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)C(F)F)cc1)N1CC(c2ccc3c(c2)OCO3)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C25H19F4N3O4/c26-23(27)25(28,29)36-18-9-7-17(8-10-18)30-24(33)32-13-19(22(31-32)15-4-2-1-3-5-15)16-6-11-20-21(12-16)35-14-34-20/h1-12,19,23H,13-14H2,(H,30,33) |
| InChIKey | ZCKMTKBNSZEVMZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|