C27H19F6N3O5 — CID 21294623
5-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 21294623) has the molecular formula C27H19F6N3O5 and a molecular weight of 579.45 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 21294623 |
| Molecular Formula | C27H19F6N3O5 |
| Molecular Weight | 579.45 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(F)(F)C(F)(F)O2)N1CC(c2ccc3c(c2)OCCO3)C(c2ccc(OC(F)F)cc2)=N1 |
| InChI | InChI=1S/C27H19F6N3O5/c28-24(29)40-17-5-1-14(2-6-17)23-18(15-3-7-21-22(11-15)39-10-9-38-21)13-36(35-23)25(37)34-16-4-8-20-19(12-16)26(30,31)27(32,33)41-20/h1-8,11-12,18,24H,9-10,13H2,(H,34,37) |
| InChIKey | RPJGRKAQUCRJFX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|