About bis(benzotriazol-1-yl) butanebis(dithioate)
bis(benzotriazol-1-yl) butanebis(dithioate) (PubChem CID 134115843) has the molecular formula C16H12N6S4
and a molecular weight of 416.58 g/mol. Its IUPAC name is bis(benzotriazol-1-yl) butanebis(dithioate).
Molecular Properties
| Compound Name | bis(benzotriazol-1-yl) butanebis(dithioate) |
| PubChem CID | 134115843 |
| Molecular Formula | C16H12N6S4 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | bis(benzotriazol-1-yl) butanebis(dithioate) |
| SMILES | S=C(CCC(=S)Sn1nnc2ccccc21)Sn1nnc2ccccc21 |
| InChI | InChI=1S/C16H12N6S4/c23-15(25-21-13-7-3-1-5-11(13)17-19-21)9-10-16(24)26-22-14-8-4-2-6-12(14)18-20-22/h1-8H,9-10H2 |
| InChIKey | YUOALRGPHROFII-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(benzotriazol-1-yl) butanebis(dithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzotriazol-1-yl) butanebis(dithioate)?
The IUPAC name of bis(benzotriazol-1-yl) butanebis(dithioate) (CID 134115843) is bis(benzotriazol-1-yl) butanebis(dithioate).
What is the SMILES notation for bis(benzotriazol-1-yl) butanebis(dithioate)?
The canonical SMILES for bis(benzotriazol-1-yl) butanebis(dithioate) is S=C(CCC(=S)Sn1nnc2ccccc21)Sn1nnc2ccccc21.
What is the InChIKey of bis(benzotriazol-1-yl) butanebis(dithioate)?
The InChIKey is YUOALRGPHROFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6S4/c23-15(25-21-13-7-3-1-5-11(13)17-19-21)9-10-16(24)26-22-14-8-4-2-6-12(14)18-20-22/h1-8H,9-10H2.
What are the key properties of bis(benzotriazol-1-yl) butanebis(dithioate)?
bis(benzotriazol-1-yl) butanebis(dithioate) has a molecular weight of 416.58 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzotriazol-1-yl) butanebis(dithioate) is sourced from PubChem (CID 134115843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).