C12H7Cl3N2O — CID 134116481
3-chloro-6-[4-(2,2-dichloroethenyl)phenoxy]pyridazine (PubChem CID 134116481) has the molecular formula C12H7Cl3N2O and a molecular weight of 301.56 g/mol. Its IUPAC name is 3-chloro-6-[4-(2,2-dichloroethenyl)phenoxy]pyridazine.
| Compound Name | 3-chloro-6-[4-(2,2-dichloroethenyl)phenoxy]pyridazine |
|---|---|
| PubChem CID | 134116481 |
| Molecular Formula | C12H7Cl3N2O |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3-chloro-6-[4-(2,2-dichloroethenyl)phenoxy]pyridazine |
| SMILES | ClC(Cl)=Cc1ccc(Oc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C12H7Cl3N2O/c13-10(14)7-8-1-3-9(4-2-8)18-12-6-5-11(15)16-17-12/h1-7H |
| InChIKey | OQFBUFUPSJMBSR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |