C14H9Cl3N4O — CID 87882017
3-chloro-6-phenoxypyridazine;3,6-dichloropyridazine (PubChem CID 87882017) has the molecular formula C14H9Cl3N4O and a molecular weight of 355.61 g/mol. Its IUPAC name is 3-chloro-6-phenoxypyridazine;3,6-dichloropyridazine.
| Compound Name | 3-chloro-6-phenoxypyridazine;3,6-dichloropyridazine |
|---|---|
| PubChem CID | 87882017 |
| Molecular Formula | C14H9Cl3N4O |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 3-chloro-6-phenoxypyridazine;3,6-dichloropyridazine |
| SMILES | Clc1ccc(Cl)nn1.Clc1ccc(Oc2ccccc2)nn1 |
| InChI | InChI=1S/C10H7ClN2O.C4H2Cl2N2/c11-9-6-7-10(13-12-9)14-8-4-2-1-3-5-8;5-3-1-2-4(6)8-7-3/h1-7H;1-2H |
| InChIKey | GOTDWLAVOFYOCV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |