C15H21N3O — CID 134116644
3-(dimethylamino)spiro[1H-quinazoline-2,1'-cyclohexane]-4-one (PubChem CID 134116644) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(dimethylamino)spiro[1H-quinazoline-2,1'-cyclohexane]-4-one.
| Compound Name | 3-(dimethylamino)spiro[1H-quinazoline-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 134116644 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-(dimethylamino)spiro[1H-quinazoline-2,1'-cyclohexane]-4-one |
| SMILES | CN(C)N1C(=O)c2ccccc2NC12CCCCC2 |
| InChI | InChI=1S/C15H21N3O/c1-17(2)18-14(19)12-8-4-5-9-13(12)16-15(18)10-6-3-7-11-15/h4-5,8-9,16H,3,6-7,10-11H2,1-2H3 |
| InChIKey | IHPCNXDZMNSLRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |