C21H19ClN4OS — CID 134116682
2-[(2-chlorophenyl)carbamothioylamino]-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 134116682) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)carbamothioylamino]-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 2-[(2-chlorophenyl)carbamothioylamino]-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 134116682 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-[(2-chlorophenyl)carbamothioylamino]-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccccn1)c1ccccc1NC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN4OS/c22-17-9-2-4-11-19(17)26-21(28)25-18-10-3-1-8-16(18)20(27)24-14-12-15-7-5-6-13-23-15/h1-11,13H,12,14H2,(H,24,27)(H2,25,26,28) |
| InChIKey | UEASGGUUMCMOMF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|