C22H20ClN3OS — CID 100642465
2-[(4-chlorophenyl)carbamothioylamino]-N-(2-phenylethyl)benzamide (PubChem CID 100642465) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamothioylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[(4-chlorophenyl)carbamothioylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 100642465 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamothioylamino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccccc1NC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3OS/c23-17-10-12-18(13-11-17)25-22(28)26-20-9-5-4-8-19(20)21(27)24-15-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,24,27)(H2,25,26,28) |
| InChIKey | OLXVKIQJLUFWGQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|