C25H22ClN3O2S — CID 17195724
2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide (PubChem CID 17195724) has the molecular formula C25H22ClN3O2S and a molecular weight of 463.99 g/mol. Its IUPAC name is 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 17195724 |
| Molecular Formula | C25H22ClN3O2S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C25H22ClN3O2S/c26-20-13-10-19(11-14-20)12-15-23(30)29-25(32)28-22-9-5-4-8-21(22)24(31)27-17-16-18-6-2-1-3-7-18/h1-15H,16-17H2,(H,27,31)(H2,28,29,30,32)/b15-12+ |
| InChIKey | OHPVVRHLQUFAJN-NTCAYCPXSA-N |
| XLogP | 4.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|