C17H12ClF3N2OS — CID 18823213
(E)-3-(4-chlorophenyl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 18823213) has the molecular formula C17H12ClF3N2OS and a molecular weight of 384.81 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 18823213 |
| Molecular Formula | C17H12ClF3N2OS |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H12ClF3N2OS/c18-12-8-5-11(6-9-12)7-10-15(24)23-16(25)22-14-4-2-1-3-13(14)17(19,20)21/h1-10H,(H2,22,23,24,25)/b10-7+ |
| InChIKey | ZXPLNTIUFSVDNG-JXMROGBWSA-N |
| XLogP | 4.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|