C13H13ClN2O3S — CID 18823221
methyl 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]acetate (PubChem CID 18823221) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]acetate.
| Compound Name | methyl 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]acetate |
|---|---|
| PubChem CID | 18823221 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | methyl 2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]acetate |
| SMILES | COC(=O)CNC(=S)NC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-19-12(18)8-15-13(20)16-11(17)7-4-9-2-5-10(14)6-3-9/h2-7H,8H2,1H3,(H2,15,16,17,20)/b7-4+ |
| InChIKey | IFRSQWMBANHPPE-QPJJXVBHSA-N |
| XLogP | 1.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|