C20H31N3O4 — CID 134117698
2-nitro-1-N,1-N,4-N,4-N-tetra(propan-2-yl)benzene-1,4-dicarboxamide (PubChem CID 134117698) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-nitro-1-N,1-N,4-N,4-N-tetra(propan-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 2-nitro-1-N,1-N,4-N,4-N-tetra(propan-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 134117698 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2-nitro-1-N,1-N,4-N,4-N-tetra(propan-2-yl)benzene-1,4-dicarboxamide |
| SMILES | CC(C)N(C(=O)c1ccc(C(=O)N(C(C)C)C(C)C)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C20H31N3O4/c1-12(2)21(13(3)4)19(24)16-9-10-17(18(11-16)23(26)27)20(25)22(14(5)6)15(7)8/h9-15H,1-8H3 |
| InChIKey | WNMQZTOTRSOJJL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|