C26H28N4OS — CID 134117950
4-[4-(4-methoxyphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 134117950) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-methoxyphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 134117950 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-5-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | COc1ccc(-n2c(SCc3c(C)c(C)c(C)c(C)c3C)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C26H28N4OS/c1-16-17(2)19(4)24(20(5)18(16)3)15-32-26-29-28-25(21-11-13-27-14-12-21)30(26)22-7-9-23(31-6)10-8-22/h7-14H,15H2,1-6H3 |
| InChIKey | JVVNBEOKDQTAGV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |