C22H24N6OS — CID 56528048
4-[4-(4-methoxyphenyl)-5-(5-pyrazol-1-ylpentylsulfanyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 56528048) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-5-(5-pyrazol-1-ylpentylsulfanyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-(4-methoxyphenyl)-5-(5-pyrazol-1-ylpentylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 56528048 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-5-(5-pyrazol-1-ylpentylsulfanyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | COc1ccc(-n2c(SCCCCCn3cccn3)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C22H24N6OS/c1-29-20-8-6-19(7-9-20)28-21(18-10-13-23-14-11-18)25-26-22(28)30-17-4-2-3-15-27-16-5-12-24-27/h5-14,16H,2-4,15,17H2,1H3 |
| InChIKey | DZWZNYNFJACICM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|