C14H19N3OS — CID 134118818
N-(4-ethylphenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide (PubChem CID 134118818) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 134118818 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(4-ethylphenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CC(C)(C)NC2=S)cc1 |
| InChI | InChI=1S/C14H19N3OS/c1-4-10-5-7-11(8-6-10)15-12(18)17-9-14(2,3)16-13(17)19/h5-8H,4,9H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | ANUSZYBSYUXMGN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|