C17H23N3O3S — CID 134094315
butyl 4-[(4,4-dimethyl-2-sulfanylideneimidazolidine-1-carbonyl)amino]benzoate (PubChem CID 134094315) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is butyl 4-[(4,4-dimethyl-2-sulfanylideneimidazolidine-1-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(4,4-dimethyl-2-sulfanylideneimidazolidine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 134094315 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | butyl 4-[(4,4-dimethyl-2-sulfanylideneimidazolidine-1-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N2CC(C)(C)NC2=S)cc1 |
| InChI | InChI=1S/C17H23N3O3S/c1-4-5-10-23-14(21)12-6-8-13(9-7-12)18-15(22)20-11-17(2,3)19-16(20)24/h6-9H,4-5,10-11H2,1-3H3,(H,18,22)(H,19,24) |
| InChIKey | VOXYVIRFABWWQG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|