C17H22N2O2S — CID 25220175
butyl 4-(6,6-dimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)benzoate (PubChem CID 25220175) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is butyl 4-(6,6-dimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)benzoate.
| Compound Name | butyl 4-(6,6-dimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)benzoate |
|---|---|
| PubChem CID | 25220175 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | butyl 4-(6,6-dimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C=CC(C)(C)NC2=S)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-4-5-12-21-15(20)13-6-8-14(9-7-13)19-11-10-17(2,3)18-16(19)22/h6-11H,4-5,12H2,1-3H3,(H,18,22) |
| InChIKey | FFHWHSIVUHUBPG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|