C17H21ClNO6- — CID 134119846
(Z)-2-[[2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]-1,3-dimethoxy-3-oxoprop-1-en-1-olate (PubChem CID 134119846) has the molecular formula C17H21ClNO6- and a molecular weight of 370.81 g/mol. Its IUPAC name is (Z)-2-[[2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]-1,3-dimethoxy-3-oxoprop-1-en-1-olate.
| Compound Name | (Z)-2-[[2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]-1,3-dimethoxy-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 134119846 |
| Molecular Formula | C17H21ClNO6- |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (Z)-2-[[2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]-1,3-dimethoxy-3-oxoprop-1-en-1-olate |
| SMILES | COC(=O)/C(Cc1ccc(NC(=O)OC(C)(C)C)cc1Cl)=C(/[O-])OC |
| InChI | InChI=1S/C17H22ClNO6/c1-17(2,3)25-16(22)19-11-7-6-10(13(18)9-11)8-12(14(20)23-4)15(21)24-5/h6-7,9,20H,8H2,1-5H3,(H,19,22)/p-1/b14-12- |
| InChIKey | QNRXCCKBOAXJRK-OWBHPGMISA-M |
| XLogP | 2.62 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|