C21H21N5O3 — CID 134120375
1-[(6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3-carbonyl)amino]-3-naphthalen-1-ylurea (PubChem CID 134120375) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[(6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3-carbonyl)amino]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3-carbonyl)amino]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 134120375 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[(6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3-carbonyl)amino]-3-naphthalen-1-ylurea |
| SMILES | CC1CCCc2ncc(C(=O)NNC(=O)Nc3cccc4ccccc34)c(=O)n21 |
| InChI | InChI=1S/C21H21N5O3/c1-13-6-4-11-18-22-12-16(20(28)26(13)18)19(27)24-25-21(29)23-17-10-5-8-14-7-2-3-9-15(14)17/h2-3,5,7-10,12-13H,4,6,11H2,1H3,(H,24,27)(H2,23,25,29) |
| InChIKey | KBIUAHFFFHHTKG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|