C12H21NS2 — CID 134121070
4-(2-methylpropylamino)-2-propan-2-yl-2,3-dihydrothiopyran-6-thione (PubChem CID 134121070) has the molecular formula C12H21NS2 and a molecular weight of 243.44 g/mol. Its IUPAC name is 4-(2-methylpropylamino)-2-propan-2-yl-2,3-dihydrothiopyran-6-thione.
| Compound Name | 4-(2-methylpropylamino)-2-propan-2-yl-2,3-dihydrothiopyran-6-thione |
|---|---|
| PubChem CID | 134121070 |
| Molecular Formula | C12H21NS2 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(2-methylpropylamino)-2-propan-2-yl-2,3-dihydrothiopyran-6-thione |
| SMILES | CC(C)CNC1=CC(=S)SC(C(C)C)C1 |
| InChI | InChI=1S/C12H21NS2/c1-8(2)7-13-10-5-11(9(3)4)15-12(14)6-10/h6,8-9,11,13H,5,7H2,1-4H3 |
| InChIKey | XSNSUPYKPWEXHB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|