C19H20N2O — CID 134122178
CID 134122178 (PubChem CID 134122178) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol.
| Compound Name | CID 134122178 |
|---|---|
| PubChem CID | 134122178 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | — |
| SMILES | [C]=NC(C(=O)NC1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H20N2O/c1-20-18(19(22)21-17-9-3-2-4-10-17)16-12-11-14-7-5-6-8-15(14)13-16/h5-8,11-13,17-18H,2-4,9-10H2,(H,21,22) |
| InChIKey | SORLDGPJCDXEQG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|