C14H14F3N3OS — CID 134122540
3,4,4-trifluorobut-3-enyl N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidothioate (PubChem CID 134122540) has the molecular formula C14H14F3N3OS and a molecular weight of 329.35 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidothioate.
| Compound Name | 3,4,4-trifluorobut-3-enyl N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 134122540 |
| Molecular Formula | C14H14F3N3OS |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidothioate |
| SMILES | COc1ccc(C/N=C(/NC#N)SCCC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C14H14F3N3OS/c1-21-11-4-2-10(3-5-11)8-19-14(20-9-18)22-7-6-12(15)13(16)17/h2-5H,6-8H2,1H3,(H,19,20) |
| InChIKey | GJXRDAMTSNMXFB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|