C10H14ClN5O — CID 166825471
N'-[[N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]carbamimidoyl chloride (PubChem CID 166825471) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is N'-[[N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]carbamimidoyl chloride.
| Compound Name | N'-[[N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]carbamimidoyl chloride |
|---|---|
| PubChem CID | 166825471 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N'-[[N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]carbamimidoyl chloride |
| SMILES | COc1ccc(C/N=C(\N)N/N=C(\N)Cl)cc1 |
| InChI | InChI=1S/C10H14ClN5O/c1-17-8-4-2-7(3-5-8)6-14-10(13)16-15-9(11)12/h2-5H,6H2,1H3,(H2,12,15)(H3,13,14,16) |
| InChIKey | ZNKKHZDPVXMINU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|