C10H12BrCl3N2O — CID 12504699
2-bromo-2,2-dichloro-N'-[(4-methoxyphenyl)methyl]ethanimidamide;hydrochloride (PubChem CID 12504699) has the molecular formula C10H12BrCl3N2O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-bromo-2,2-dichloro-N'-[(4-methoxyphenyl)methyl]ethanimidamide;hydrochloride.
| Compound Name | 2-bromo-2,2-dichloro-N'-[(4-methoxyphenyl)methyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 12504699 |
| Molecular Formula | C10H12BrCl3N2O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | 2-bromo-2,2-dichloro-N'-[(4-methoxyphenyl)methyl]ethanimidamide;hydrochloride |
| SMILES | COc1ccc(C/N=C(\N)C(Cl)(Cl)Br)cc1.Cl |
| InChI | InChI=1S/C10H11BrCl2N2O.ClH/c1-16-8-4-2-7(3-5-8)6-15-9(14)10(11,12)13;/h2-5H,6H2,1H3,(H2,14,15);1H |
| InChIKey | BOQMEXUGXBYORG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|