C14H24ClN5O — CID 53307927
1-butyl-3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]guanidine;hydrochloride (PubChem CID 53307927) has the molecular formula C14H24ClN5O and a molecular weight of 313.83 g/mol. Its IUPAC name is 1-butyl-3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]guanidine;hydrochloride.
| Compound Name | 1-butyl-3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 53307927 |
| Molecular Formula | C14H24ClN5O |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-butyl-3-(diaminomethylidene)-2-[(4-methoxyphenyl)methyl]guanidine;hydrochloride |
| SMILES | CCCCN/C(N=C(N)N)=N\Cc1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C14H23N5O.ClH/c1-3-4-9-17-14(19-13(15)16)18-10-11-5-7-12(20-2)8-6-11;/h5-8H,3-4,9-10H2,1-2H3,(H5,15,16,17,18,19);1H |
| InChIKey | ZGZDJCLHTZKPQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|