C17H17ClF2O3 — CID 134123415
2-[(4-chlorophenoxy)methyl]-1,3-bis(2-fluoroethoxy)benzene (PubChem CID 134123415) has the molecular formula C17H17ClF2O3 and a molecular weight of 342.77 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-1,3-bis(2-fluoroethoxy)benzene.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-1,3-bis(2-fluoroethoxy)benzene |
|---|---|
| PubChem CID | 134123415 |
| Molecular Formula | C17H17ClF2O3 |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-1,3-bis(2-fluoroethoxy)benzene |
| SMILES | FCCOc1cccc(OCCF)c1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClF2O3/c18-13-4-6-14(7-5-13)23-12-15-16(21-10-8-19)2-1-3-17(15)22-11-9-20/h1-7H,8-12H2 |
| InChIKey | QWBMIMNSCFIACJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |