C18H20F2O4 — CID 134092285
1,3-bis(2-fluoroethoxy)-2-[(4-methoxyphenoxy)methyl]benzene (PubChem CID 134092285) has the molecular formula C18H20F2O4 and a molecular weight of 338.35 g/mol. Its IUPAC name is 1,3-bis(2-fluoroethoxy)-2-[(4-methoxyphenoxy)methyl]benzene.
| Compound Name | 1,3-bis(2-fluoroethoxy)-2-[(4-methoxyphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 134092285 |
| Molecular Formula | C18H20F2O4 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1,3-bis(2-fluoroethoxy)-2-[(4-methoxyphenoxy)methyl]benzene |
| SMILES | COc1ccc(OCc2c(OCCF)cccc2OCCF)cc1 |
| InChI | InChI=1S/C18H20F2O4/c1-21-14-5-7-15(8-6-14)24-13-16-17(22-11-9-19)3-2-4-18(16)23-12-10-20/h2-8H,9-13H2,1H3 |
| InChIKey | UQVXVFLLNRNULQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |