C16H19N5O2 — CID 134123595
(Z)-2-(2,2-dimethylpropylamino)-3-[(2-nitrophenyl)methylamino]but-2-enedinitrile (PubChem CID 134123595) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (Z)-2-(2,2-dimethylpropylamino)-3-[(2-nitrophenyl)methylamino]but-2-enedinitrile.
| Compound Name | (Z)-2-(2,2-dimethylpropylamino)-3-[(2-nitrophenyl)methylamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 134123595 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (Z)-2-(2,2-dimethylpropylamino)-3-[(2-nitrophenyl)methylamino]but-2-enedinitrile |
| SMILES | CC(C)(C)CN/C(C#N)=C(/C#N)NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N5O2/c1-16(2,3)11-20-14(9-18)13(8-17)19-10-12-6-4-5-7-15(12)21(22)23/h4-7,19-20H,10-11H2,1-3H3/b14-13- |
| InChIKey | HQZDUIZPYJCCBZ-YPKPFQOOSA-N |
| XLogP | 2.58 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|