C16H11Cl2NO4S — CID 134125272
N-(3,4-dichlorophenyl)-2,2,4-trioxo-1H-isothiochromene-3-carboxamide (PubChem CID 134125272) has the molecular formula C16H11Cl2NO4S and a molecular weight of 384.24 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,2,4-trioxo-1H-isothiochromene-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,2,4-trioxo-1H-isothiochromene-3-carboxamide |
|---|---|
| PubChem CID | 134125272 |
| Molecular Formula | C16H11Cl2NO4S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,2,4-trioxo-1H-isothiochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1C(=O)c2ccccc2CS1(=O)=O |
| InChI | InChI=1S/C16H11Cl2NO4S/c17-12-6-5-10(7-13(12)18)19-16(21)15-14(20)11-4-2-1-3-9(11)8-24(15,22)23/h1-7,15H,8H2,(H,19,21) |
| InChIKey | OZGGIRZVJWEBHU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|