C24H25F2N3O2 — CID 134125310
3-[4-[8-fluoro-5-(4-fluorophenyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butyl]-1,3-oxazolidin-2-one (PubChem CID 134125310) has the molecular formula C24H25F2N3O2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 3-[4-[8-fluoro-5-(4-fluorophenyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-[8-fluoro-5-(4-fluorophenyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134125310 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[4-[8-fluoro-5-(4-fluorophenyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]butyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCCCN1CCc2c(c3cc(F)ccc3n2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H25F2N3O2/c25-17-3-6-19(7-4-17)29-22-8-5-18(26)15-20(22)21-16-27(12-9-23(21)29)10-1-2-11-28-13-14-31-24(28)30/h3-8,15H,1-2,9-14,16H2 |
| InChIKey | PREVQKQRNOVERX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|