C20H14N4S — CID 134126891
2-[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]-1,3-benzothiazole (PubChem CID 134126891) has the molecular formula C20H14N4S and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 134126891 |
| Molecular Formula | C20H14N4S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc(Cn2c(-c3nc4ccccc4s3)nc3ccccc32)nc1 |
| InChI | InChI=1S/C20H14N4S/c1-3-10-17-15(8-1)22-19(24(17)13-14-7-5-6-12-21-14)20-23-16-9-2-4-11-18(16)25-20/h1-12H,13H2 |
| InChIKey | GKPQFBSVRSBVRF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |