C23H32O2S — CID 134128390
(8R,9S,13S,14S)-13-methyl-3-(4-methylsulfanylbutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 134128390) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-(4-methylsulfanylbutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-(4-methylsulfanylbutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 134128390 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-(4-methylsulfanylbutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CSCCCCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H32O2S/c1-23-12-11-19-18-8-6-17(25-13-3-4-14-26-2)15-16(18)5-7-20(19)21(23)9-10-22(23)24/h6,8,15,19-21H,3-5,7,9-14H2,1-2H3/t19-,20-,21+,23+/m1/s1 |
| InChIKey | IGLOCPYPGVDMTR-JFYQVNSESA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|