C21H18FN3O3 — CID 134131481
N-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]-8-methoxy-2H-chromene-3-carboxamide (PubChem CID 134131481) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]-8-methoxy-2H-chromene-3-carboxamide.
| Compound Name | N-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]-8-methoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 134131481 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]-8-methoxy-2H-chromene-3-carboxamide |
| SMILES | COc1cccc2c1OCC(C(=O)NCc1ncc(-c3ccc(F)cc3)[nH]1)=C2 |
| InChI | InChI=1S/C21H18FN3O3/c1-27-18-4-2-3-14-9-15(12-28-20(14)18)21(26)24-11-19-23-10-17(25-19)13-5-7-16(22)8-6-13/h2-10H,11-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RAJDZTMOAFQUGY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |