C24H32N2O2Se2 — CID 134132713
N-(3-methylbutyl)-2-[[2-(3-methylbutylcarbamoyl)phenyl]diselanyl]benzamide (PubChem CID 134132713) has the molecular formula C24H32N2O2Se2 and a molecular weight of 538.45 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[[2-(3-methylbutylcarbamoyl)phenyl]diselanyl]benzamide.
| Compound Name | N-(3-methylbutyl)-2-[[2-(3-methylbutylcarbamoyl)phenyl]diselanyl]benzamide |
|---|---|
| PubChem CID | 134132713 |
| Molecular Formula | C24H32N2O2Se2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | N-(3-methylbutyl)-2-[[2-(3-methylbutylcarbamoyl)phenyl]diselanyl]benzamide |
| SMILES | CC(C)CCNC(=O)c1ccccc1[Se][Se]c1ccccc1C(=O)NCCC(C)C |
| InChI | InChI=1S/C24H32N2O2Se2/c1-17(2)13-15-25-23(27)19-9-5-7-11-21(19)29-30-22-12-8-6-10-20(22)24(28)26-16-14-18(3)4/h5-12,17-18H,13-16H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | OPPSUFVFBRDQSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|