C17H15N3O4 — CID 134133711
1,3-dimethyl-N-naphthalen-2-yl-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 134133711) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1,3-dimethyl-N-naphthalen-2-yl-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | 1,3-dimethyl-N-naphthalen-2-yl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134133711 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1,3-dimethyl-N-naphthalen-2-yl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | CN1C(=O)C(C(=O)Nc2ccc3ccccc3c2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H15N3O4/c1-19-15(22)13(16(23)20(2)17(19)24)14(21)18-12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13H,1-2H3,(H,18,21) |
| InChIKey | QVMRQJOHSHGTCV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|