C28H32F5N3O6 — CID 134133742
3-[(1S,5R)-8-[2-[(2,6-difluorophenyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 134133742) has the molecular formula C28H32F5N3O6 and a molecular weight of 601.57 g/mol. Its IUPAC name is 3-[(1S,5R)-8-[2-[(2,6-difluorophenyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(1S,5R)-8-[2-[(2,6-difluorophenyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134133742 |
| Molecular Formula | C28H32F5N3O6 |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 3-[(1S,5R)-8-[2-[(2,6-difluorophenyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(C2C[C@H]3CC[C@@H](C2)N3CCN(Cc2c(F)cccc2F)C(=O)[C@@H](O)CO)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H31F2N3O4.C2HF3O2/c27-22-5-2-6-23(28)21(22)14-30(26(35)24(33)15-32)9-10-31-19-7-8-20(31)13-18(12-19)16-3-1-4-17(11-16)25(29)34;3-2(4,5)1(6)7/h1-6,11,18-20,24,32-33H,7-10,12-15H2,(H2,29,34);(H,6,7)/t18?,19-,20+,24-;/m0./s1 |
| InChIKey | XWEAOTYPNQQVDL-JZZAGHSJSA-N |
| XLogP | 2.79 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |