C25H22N8OS — CID 134135115
(5Z)-2-(4-ethylphenyl)imino-3-methyl-5-[[2-[4-(2H-tetrazol-5-yl)anilino]-4-pyridinyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 134135115) has the molecular formula C25H22N8OS and a molecular weight of 482.57 g/mol. Its IUPAC name is (5Z)-2-(4-ethylphenyl)imino-3-methyl-5-[[2-[4-(2H-tetrazol-5-yl)anilino]-4-pyridinyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-ethylphenyl)imino-3-methyl-5-[[2-[4-(2H-tetrazol-5-yl)anilino]-4-pyridinyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134135115 |
| Molecular Formula | C25H22N8OS |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (5Z)-2-(4-ethylphenyl)imino-3-methyl-5-[[2-[4-(2H-tetrazol-5-yl)anilino]-4-pyridinyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2/S/C(=C\c3ccnc(Nc4ccc(-c5nn[nH]n5)cc4)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C25H22N8OS/c1-3-16-4-8-20(9-5-16)28-25-33(2)24(34)21(35-25)14-17-12-13-26-22(15-17)27-19-10-6-18(7-11-19)23-29-31-32-30-23/h4-15H,3H2,1-2H3,(H,26,27)(H,29,30,31,32)/b21-14-,28-25+ |
| InChIKey | WWPZBBQLQAEXGE-KAOCIJRYSA-N |
| XLogP | 4.80 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|