C21H23N5O2S — CID 134140976
3-amino-N-[4-[(Z)-[2-(4-ethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]propanamide (PubChem CID 134140976) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 3-amino-N-[4-[(Z)-[2-(4-ethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]propanamide.
| Compound Name | 3-amino-N-[4-[(Z)-[2-(4-ethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 134140976 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-amino-N-[4-[(Z)-[2-(4-ethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]propanamide |
| SMILES | CCc1ccc(/N=C2/S/C(=C\c3ccnc(NC(=O)CCN)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-3-14-4-6-16(7-5-14)24-21-26(2)20(28)17(29-21)12-15-9-11-23-18(13-15)25-19(27)8-10-22/h4-7,9,11-13H,3,8,10,22H2,1-2H3,(H,23,25,27)/b17-12-,24-21+ |
| InChIKey | SZHBLQHIMVPWLH-YAGPLZKVSA-N |
| XLogP | 3.17 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|