C27H34N2O2S — CID 6372131
(5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 6372131) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6372131 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\S/C(=C/c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C27H34N2O2S/c1-9-17-10-12-19(13-11-17)28-25-29(8)24(31)22(32-25)16-18-14-20(26(2,3)4)23(30)21(15-18)27(5,6)7/h10-16,30H,9H2,1-8H3/b22-16+,28-25- |
| InChIKey | YVGXNSQZAWMGDZ-JCYYTGCGSA-N |
| XLogP | 6.78 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|