C22H18Cl2N4O2 — CID 134135450
7-chloro-2-[2-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]ethylamino]-3-methylquinazolin-4-one (PubChem CID 134135450) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 7-chloro-2-[2-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]ethylamino]-3-methylquinazolin-4-one.
| Compound Name | 7-chloro-2-[2-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]ethylamino]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 134135450 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 7-chloro-2-[2-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]ethylamino]-3-methylquinazolin-4-one |
| SMILES | Cn1c(NCCc2ccc(Oc3ccc(Cl)cn3)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-28-21(29)18-8-4-15(23)12-19(18)27-22(28)25-11-10-14-2-6-17(7-3-14)30-20-9-5-16(24)13-26-20/h2-9,12-13H,10-11H2,1H3,(H,25,27) |
| InChIKey | DZIQIHRAOSKYAB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |