C21H20ClN5O2 — CID 118859085
2-[6-amino-2-[[4-[(5-chloro-2-pyridinyl)oxy]phenyl]methylamino]benzimidazol-1-yl]ethanol (PubChem CID 118859085) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 2-[6-amino-2-[[4-[(5-chloro-2-pyridinyl)oxy]phenyl]methylamino]benzimidazol-1-yl]ethanol.
| Compound Name | 2-[6-amino-2-[[4-[(5-chloro-2-pyridinyl)oxy]phenyl]methylamino]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 118859085 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[6-amino-2-[[4-[(5-chloro-2-pyridinyl)oxy]phenyl]methylamino]benzimidazol-1-yl]ethanol |
| SMILES | Nc1ccc2nc(NCc3ccc(Oc4ccc(Cl)cn4)cc3)n(CCO)c2c1 |
| InChI | InChI=1S/C21H20ClN5O2/c22-15-3-8-20(24-13-15)29-17-5-1-14(2-6-17)12-25-21-26-18-7-4-16(23)11-19(18)27(21)9-10-28/h1-8,11,13,28H,9-10,12,23H2,(H,25,26) |
| InChIKey | COOFVFWWGPQYAF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|