C21H18F3N5O — CID 118858431
3-methyl-2-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methyl]benzimidazole-2,5-diamine (PubChem CID 118858431) has the molecular formula C21H18F3N5O and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-methyl-2-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methyl]benzimidazole-2,5-diamine.
| Compound Name | 3-methyl-2-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methyl]benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 118858431 |
| Molecular Formula | C21H18F3N5O |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-methyl-2-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]methyl]benzimidazole-2,5-diamine |
| SMILES | Cn1c(NCc2ccc(Oc3ccc(C(F)(F)F)nc3)cc2)nc2ccc(N)cc21 |
| InChI | InChI=1S/C21H18F3N5O/c1-29-18-10-14(25)4-8-17(18)28-20(29)27-11-13-2-5-15(6-3-13)30-16-7-9-19(26-12-16)21(22,23)24/h2-10,12H,11,25H2,1H3,(H,27,28) |
| InChIKey | SZJSUJNNFQLTOU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|