C16H18N4 — CID 59674118
1-methyl-2-N-[(4-methylphenyl)methyl]benzimidazole-2,5-diamine (PubChem CID 59674118) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-methyl-2-N-[(4-methylphenyl)methyl]benzimidazole-2,5-diamine.
| Compound Name | 1-methyl-2-N-[(4-methylphenyl)methyl]benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 59674118 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-methyl-2-N-[(4-methylphenyl)methyl]benzimidazole-2,5-diamine |
| SMILES | Cc1ccc(CNc2nc3cc(N)ccc3n2C)cc1 |
| InChI | InChI=1S/C16H18N4/c1-11-3-5-12(6-4-11)10-18-16-19-14-9-13(17)7-8-15(14)20(16)2/h3-9H,10,17H2,1-2H3,(H,18,19) |
| InChIKey | QBDCDPWRKYOVEG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|