C25H23N5O — CID 163533152
3-methyl-2-N-[[4-(8-methylquinolin-2-yl)oxyphenyl]methyl]benzimidazole-2,5-diamine (PubChem CID 163533152) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-methyl-2-N-[[4-(8-methylquinolin-2-yl)oxyphenyl]methyl]benzimidazole-2,5-diamine.
| Compound Name | 3-methyl-2-N-[[4-(8-methylquinolin-2-yl)oxyphenyl]methyl]benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 163533152 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-methyl-2-N-[[4-(8-methylquinolin-2-yl)oxyphenyl]methyl]benzimidazole-2,5-diamine |
| SMILES | Cc1cccc2ccc(Oc3ccc(CNc4nc5ccc(N)cc5n4C)cc3)nc12 |
| InChI | InChI=1S/C25H23N5O/c1-16-4-3-5-18-8-13-23(29-24(16)18)31-20-10-6-17(7-11-20)15-27-25-28-21-12-9-19(26)14-22(21)30(25)2/h3-14H,15,26H2,1-2H3,(H,27,28) |
| InChIKey | DURVFYRZQJMHQB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|